CAS 156610-89-8 is the registry number for 1,5,6,7-Tetrahydro-5-(phosphonomethyl)-imidazo(1,2-a)pyrimidine-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
5-(phosphonomethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylic acid (CAS 156610-89-8) is a chemical compound with the molecular formula C8H12N3O5P and a molecular weight of 261.17 g/mol. IUPAC name: 5-(phosphonomethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylic acid. InChIKey: KEQRUNZNYPPDLV-UHFFFAOYSA-N.
| Molecular formula | C8H12N3O5P |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | 5-(phosphonomethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine-2-carboxylic acid |
| InChIKey | KEQRUNZNYPPDLV-UHFFFAOYSA-N |
| SMILES | C1CNC2=NC(=CN2C1CP(=O)(O)O)C(=O)O |
Computed by PubChem (NCBI)