CAS 1566233-22-4 is the registry number for Sodium 2-(trifluoromethyl)benzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2-(trifluoromethyl)benzenesulfonate (CAS 1566233-22-4) is a chemical compound with the molecular formula C7H4F3NaO3S and a molecular weight of 248.16 g/mol. IUPAC name: sodium 2-(trifluoromethyl)benzenesulfonate. InChIKey: CVNHZWQQZUXFDE-UHFFFAOYSA-M.
| Molecular formula | C7H4F3NaO3S |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | sodium 2-(trifluoromethyl)benzenesulfonate |
| InChIKey | CVNHZWQQZUXFDE-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)