CAS 1566274-73-4 is the registry number for 4-Bromo-2-iodo-6-isopropylphenol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-bromo-2-iodo-6-propan-2-ylphenol (CAS 1566274-73-4) is a chemical compound with the molecular formula C9H10BrIO and a molecular weight of 340.98 g/mol. IUPAC name: 4-bromo-2-iodo-6-propan-2-ylphenol. InChIKey: XDEVGEYOFSOGMM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrIO |
|---|---|
| Molecular weight | 340.98 g/mol |
| IUPAC name | 4-bromo-2-iodo-6-propan-2-ylphenol |
| InChIKey | XDEVGEYOFSOGMM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)I)O |
Computed by PubChem (NCBI)