CAS 156632-03-0 appears in our catalog under these names: N-Nitroso Clozapine, N-Nitroso Clozapine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
3-chloro-6-(4-methylpiperazin-1-yl)-11-nitrosobenzo[b][1,4]benzodiazepine (CAS 156632-03-0) is a chemical compound with the molecular formula C18H18ClN5O and a molecular weight of 355.8 g/mol. IUPAC name: 3-chloro-6-(4-methylpiperazin-1-yl)-11-nitrosobenzo[b][1,4]benzodiazepine. InChIKey: VUYZWBPSVAKAAT-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN5O |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 3-chloro-6-(4-methylpiperazin-1-yl)-11-nitrosobenzo[b][1,4]benzodiazepine |
| InChIKey | VUYZWBPSVAKAAT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=CC(=C3)Cl)N(C4=CC=CC=C42)N=O |
Computed by PubChem (NCBI)