Products 1566356-87-3
CAS 1566356-87-3 is the registry number for 3-(4-Bromo-2-fluorophenyl)pyrazin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-2-fluorophenyl)-1H-pyrazin-2-one (CAS 1566356-87-3) is a chemical compound with the molecular formula C10H6BrFN2O and a molecular weight of 269.07 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)-1H-pyrazin-2-one. InChIKey: LTLQGMOQJMUMJN-UHFFFAOYSA-N.
| Molecular formula | C10H6BrFN2O |
|---|---|
| Molecular weight | 269.07 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)-1H-pyrazin-2-one |
| InChIKey | LTLQGMOQJMUMJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=NC=CNC2=O |
Computed by PubChem (NCBI)