Products 156673-70-0
CAS 156673-70-0 is the registry number for 1-Bromopentane-2,2,3,3,4,4,5,5,5-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-bromo-1,1,2,2,3,3,4,4,5-nonadeuteriopentane (CAS 156673-70-0) is a chemical compound with the molecular formula C5H11Br and a molecular weight of 160.10 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,4,4,5-nonadeuteriopentane. InChIKey: YZWKKMVJZFACSU-LOFGRQECSA-N.
| Molecular formula | C5H11Br |
|---|---|
| Molecular weight | 160.10 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,5-nonadeuteriopentane |
| InChIKey | YZWKKMVJZFACSU-LOFGRQECSA-N |
| SMILES | [2H]CC([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)