CAS 1566842-27-0 is the registry number for 4-(1-Hydroxy-2-methylpropan-2-yl)thiomorpholine 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropan-1-ol (CAS 1566842-27-0) is a chemical compound with the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropan-1-ol. InChIKey: QCCRLJMUVXSKAU-UHFFFAOYSA-N.
| Molecular formula | C8H17NO3S |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropan-1-ol |
| InChIKey | QCCRLJMUVXSKAU-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)N1CCS(=O)(=O)CC1 |
Computed by PubChem (NCBI)