Products 156691-84-8
CAS 156691-84-8 is the registry number for AGN 191701. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]thiophene-3-carboxylic acid (CAS 156691-84-8) is a chemical compound with the molecular formula C23H28O2S and a molecular weight of 368.5 g/mol. IUPAC name: 5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]thiophene-3-carboxylic acid. InChIKey: ZEDKEKWGCXBKCJ-NTEUORMPSA-N.
| Molecular formula | C23H28O2S |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | 5-[(E)-2-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]thiophene-3-carboxylic acid |
| InChIKey | ZEDKEKWGCXBKCJ-NTEUORMPSA-N |
| SMILES | CC1=CC2=C(C=C1/C(=C/C3=CC(=CS3)C(=O)O)/C)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)