CAS 1567064-72-5 appears in our catalog under these names: 3-Bromo-n,5-dimethylbenzamide, 95%, 3-Bromo-N,5-dimethylbenzamide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g.
3-bromo-N,5-dimethylbenzamide (CAS 1567064-72-5) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 3-bromo-N,5-dimethylbenzamide. InChIKey: PNGUSOXXWCOUEA-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 3-bromo-N,5-dimethylbenzamide |
| InChIKey | PNGUSOXXWCOUEA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)C(=O)NC |
Computed by PubChem (NCBI)