CAS 156707-43-6 appears in our catalog under these names: H-Cys-4-Abz-Met-OH, FTase Inhibitor II. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1mg, 5mg, 25mg, 10mg, 50mg, 100mg.
(2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid (CAS 156707-43-6) is a chemical compound with the molecular formula C15H21N3O4S2 and a molecular weight of 371.5 g/mol. IUPAC name: (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: QZVAZQOXHOMYJF-RYUDHWBXSA-N.
| Molecular formula | C15H21N3O4S2 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | (2S)-2-[[4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | QZVAZQOXHOMYJF-RYUDHWBXSA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)C1=CC=C(C=C1)NC(=O)[C@H](CS)N |
Computed by PubChem (NCBI)