CAS 156750-08-2 appears in our catalog under these names: 5–((3,5–Dicarboxybenzyl)oxy)isophthalic acid, 5-((3,5-Dicarboxybenzyl)oxy)isophthalic acid, 95%, 95%, 5-((3,5-Dicarboxybenzyl)oxy)isophthalic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
5-[(3,5-dicarboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid (CAS 156750-08-2) is a chemical compound with the molecular formula C17H12O9 and a molecular weight of 360.3 g/mol. IUPAC name: 5-[(3,5-dicarboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid. InChIKey: FIMMKUGFXNAMQH-UHFFFAOYSA-N.
| Molecular formula | C17H12O9 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 5-[(3,5-dicarboxyphenoxy)methyl]benzene-1,3-dicarboxylic acid |
| InChIKey | FIMMKUGFXNAMQH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)COC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)