Products 1567880-73-2
CAS 1567880-73-2 is the registry number for 3-((1R)-2-Amino-1-hydroxyethyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(1R)-2-amino-1-hydroxyethyl]benzonitrile (CAS 1567880-73-2) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: 3-[(1R)-2-amino-1-hydroxyethyl]benzonitrile. InChIKey: ZHNZFASIUKYYDA-VIFPVBQESA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 3-[(1R)-2-amino-1-hydroxyethyl]benzonitrile |
| InChIKey | ZHNZFASIUKYYDA-VIFPVBQESA-N |
| SMILES | C1=CC(=CC(=C1)[C@H](CN)O)C#N |
Computed by PubChem (NCBI)