CAS 1568-93-0 appears in our catalog under these names: 7-Methyl-1,8-naphthyridin-2-amine, 95%, 7-Methyl-1,8-naphthyridin-2-amine, 97%, 97%, 7-Methyl-1,8-naphthyridin-2-amine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
7-methyl-1,8-naphthyridin-2-amine (CAS 1568-93-0) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 7-methyl-1,8-naphthyridin-2-amine. InChIKey: ZIFGWWCUONMOLI-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 7-methyl-1,8-naphthyridin-2-amine |
| InChIKey | ZIFGWWCUONMOLI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=N2)N |
Computed by PubChem (NCBI)