Products 1568073-28-8
CAS 1568073-28-8 is the registry number for (1S)-5,7-Difluoro-1,2,3,4-tetrahydronaphthalen-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1568073-28-8) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: (1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: CKGYXCMBPBDKJQ-JTQLQIEISA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | (1S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | CKGYXCMBPBDKJQ-JTQLQIEISA-N |
| SMILES | C1C[C@@H](C2=C(C1)C(=CC(=C2)F)F)O |
Computed by PubChem (NCBI)