CAS 156835-63-1 appears in our catalog under these names: (3S,4S)-2,5-dioxotetrahydrofuran-3,4-diyl bis(4-methylbenzoate), 98%, O,O'-Di-p-toluoyl-D-tartaric anhydride, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 250mg, 1g.
[(3S,4S)-4-(4-methylbenzoyl)oxy-2,5-dioxooxolan-3-yl] 4-methylbenzoate (CAS 156835-63-1) is a chemical compound with the molecular formula C20H16O7 and a molecular weight of 368.3 g/mol. IUPAC name: [(3S,4S)-4-(4-methylbenzoyl)oxy-2,5-dioxooxolan-3-yl] 4-methylbenzoate. InChIKey: BCIJHROJBLWCLV-HOTGVXAUSA-N.
| Molecular formula | C20H16O7 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | [(3S,4S)-4-(4-methylbenzoyl)oxy-2,5-dioxooxolan-3-yl] 4-methylbenzoate |
| InChIKey | BCIJHROJBLWCLV-HOTGVXAUSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2[C@@H](C(=O)OC2=O)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)