Products 156840-74-3
CAS 156840-74-3 is the registry number for N-(1H-Benzo[d]imidazol-2-yl)-5-chlorothiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1H-benzimidazol-2-yl)-5-chlorothiophene-2-carboxamide (CAS 156840-74-3) is a chemical compound with the molecular formula C12H8ClN3OS and a molecular weight of 277.73 g/mol. IUPAC name: N-(1H-benzimidazol-2-yl)-5-chlorothiophene-2-carboxamide. InChIKey: XYLJWNKHNJOYHW-UHFFFAOYSA-N.
| Molecular formula | C12H8ClN3OS |
|---|---|
| Molecular weight | 277.73 g/mol |
| IUPAC name | N-(1H-benzimidazol-2-yl)-5-chlorothiophene-2-carboxamide |
| InChIKey | XYLJWNKHNJOYHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)NC(=O)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)