CAS 15687-40-8 appears in our catalog under these names: Octafonium chloride, 95%, N-Benzyl-N,N-diethyl-2-(4-(2,2,4-trimethylpentyl)phenoxy)ethanaminium chloride, 98%, Octaphonium Chloride. Offered by: Combi-blocks, AmBeed, LoGiCal. Available pack sizes: 250mg, 1g, 100mg, 5mg.
Benzyl-diethyl-[2-[4-(2,2,4-trimethylpentyl)phenoxy]ethyl]azanium chloride (CAS 15687-40-8) is a chemical compound with the molecular formula C27H42ClNO and a molecular weight of 432.1 g/mol. IUPAC name: benzyl-diethyl-[2-[4-(2,2,4-trimethylpentyl)phenoxy]ethyl]azanium chloride. InChIKey: QJHSDBWTZFWIGQ-UHFFFAOYSA-M.
| Molecular formula | C27H42ClNO |
|---|---|
| Molecular weight | 432.1 g/mol |
| IUPAC name | benzyl-diethyl-[2-[4-(2,2,4-trimethylpentyl)phenoxy]ethyl]azanium chloride |
| InChIKey | QJHSDBWTZFWIGQ-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CCOC1=CC=C(C=C1)CC(C)(C)CC(C)C)CC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)