Products 1569088-22-7

CAS 1569088-22-7 is the registry number for 2-Chloro-6-(3-chloro-4-fluoro-phenyl)-isonicotinic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylate (CAS 1569088-22-7) is a chemical compound with the molecular formula C13H8Cl2FNO2 and a molecular weight of 300.11 g/mol. IUPAC name: methyl 2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylate. InChIKey: UIXFOMYFQZEQCA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl2FNO2
Molecular weight300.11 g/mol
IUPAC namemethyl 2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylate
InChIKeyUIXFOMYFQZEQCA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=NC(=C1)Cl)C2=CC(=C(C=C2)F)Cl

Computed by PubChem (NCBI)