CAS 156938-77-1 is the registry number for 7-Bromo-1,3,4,5-tetrahydro-2H-benzo[b]azepine-2-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-1,3,4,5-tetrahydro-1-benzazepine-2-thione (CAS 156938-77-1) is a chemical compound with the molecular formula C10H10BrNS and a molecular weight of 256.16 g/mol. IUPAC name: 7-bromo-1,3,4,5-tetrahydro-1-benzazepine-2-thione. InChIKey: IVSBYKKZSSCOES-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNS |
|---|---|
| Molecular weight | 256.16 g/mol |
| IUPAC name | 7-bromo-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
| InChIKey | IVSBYKKZSSCOES-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)NC(=S)C1 |
Computed by PubChem (NCBI)