CAS 156941-60-5 appears in our catalog under these names: 2-(7-Bromo-1h-indol-3-yl)ethanamine hydrochloride, 95%, 2–(7–Bromo–1H–indol–3–yl)ethanamine hydrochloride, 2-(7-Bromo-1H-indol-3-yl)ethanamine hydrochloride, 2-(7-Bromo-1H-indol-3-yl)ethanamine hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
2-(7-bromo-1H-indol-3-yl)ethanamine;hydrochloride (CAS 156941-60-5) is a chemical compound with the molecular formula C10H12BrClN2 and a molecular weight of 275.57 g/mol. IUPAC name: 2-(7-bromo-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: FNGKXNLFBJRRGO-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2 |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 2-(7-bromo-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | FNGKXNLFBJRRGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC=C2CCN.Cl |
Computed by PubChem (NCBI)