CAS 15695-27-9 is the registry number for [Au(TPP)]Cl, 95.00%. Offered by: MedChemExpress. Available pack sizes: 50 mg.
Chlorogold;5,10,15,20-tetraphenylporphyrin-22,24-diide (CAS 15695-27-9) is a chemical compound with the molecular formula C44H28AuClN4-2 and a molecular weight of 845.1 g/mol. IUPAC name: chlorogold;5,10,15,20-tetraphenylporphyrin-22,24-diide. InChIKey: HNXMSTHEWGXKBL-UHFFFAOYSA-M.
| Molecular formula | C44H28AuClN4-2 |
|---|---|
| Molecular weight | 845.1 g/mol |
| IUPAC name | chlorogold;5,10,15,20-tetraphenylporphyrin-22,24-diide |
| InChIKey | HNXMSTHEWGXKBL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.Cl[Au] |
Computed by PubChem (NCBI)