CAS 1569868-40-1 is the registry number for 5,5'-(Naphthalene-2,6-diyl)bis(benzene-1,3-diamine), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[6-(3,5-diaminophenyl)naphthalen-2-yl]benzene-1,3-diamine (CAS 1569868-40-1) is a chemical compound with the molecular formula C22H20N4 and a molecular weight of 340.4 g/mol. IUPAC name: 5-[6-(3,5-diaminophenyl)naphthalen-2-yl]benzene-1,3-diamine. InChIKey: NYZWGRMNCPXEAU-UHFFFAOYSA-N.
| Molecular formula | C22H20N4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 5-[6-(3,5-diaminophenyl)naphthalen-2-yl]benzene-1,3-diamine |
| InChIKey | NYZWGRMNCPXEAU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=CC(=CC(=C3)N)N)C=C1C4=CC(=CC(=C4)N)N |
Computed by PubChem (NCBI)