CAS 157024-67-4 appears in our catalog under these names: b-Glucosylglycerol 2,3,4,6-tetraacetate, 2-(Tetraacetylglucosido)glycerol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg, Get quote.
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,3-dihydroxypropan-2-yloxy)oxan-2-yl]methyl acetate (CAS 157024-67-4) is a chemical compound with the molecular formula C17H26O12 and a molecular weight of 422.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,3-dihydroxypropan-2-yloxy)oxan-2-yl]methyl acetate. InChIKey: XZWUDSNITUMJJW-NQNKBUKLSA-N.
| Molecular formula | C17H26O12 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(1,3-dihydroxypropan-2-yloxy)oxan-2-yl]methyl acetate |
| InChIKey | XZWUDSNITUMJJW-NQNKBUKLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(CO)CO)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)