CAS 157035-77-3 is the registry number for (S)-3-(Boc-amino)-2,4-dimethyl-2-pentanol, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamate (CAS 157035-77-3) is a chemical compound with the molecular formula C12H25NO3 and a molecular weight of 231.33 g/mol. IUPAC name: tert-butyl N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamate. InChIKey: AWLRFWWWKJXWTQ-VIFPVBQESA-N.
| Molecular formula | C12H25NO3 |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | tert-butyl N-[(3S)-2-hydroxy-2,4-dimethylpentan-3-yl]carbamate |
| InChIKey | AWLRFWWWKJXWTQ-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(C)(C)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)