CAS 157072-18-9 appears in our catalog under these names: Isotrazodone, Trazodone impurity 12. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 2,5mg, Get quote.
1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2H-[1,2,4]triazolo[4,3-a]pyridin-1-ium-3-one (CAS 157072-18-9) is a chemical compound with the molecular formula C19H23ClN5O+ and a molecular weight of 372.9 g/mol. IUPAC name: 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2H-[1,2,4]triazolo[4,3-a]pyridin-1-ium-3-one. InChIKey: WGDCDCMDVKNMEF-UHFFFAOYSA-O.
| Molecular formula | C19H23ClN5O+ |
|---|---|
| Molecular weight | 372.9 g/mol |
| IUPAC name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-2H-[1,2,4]triazolo[4,3-a]pyridin-1-ium-3-one |
| InChIKey | WGDCDCMDVKNMEF-UHFFFAOYSA-O |
| SMILES | C1CN(CCN1CCC[N+]2=C3C=CC=CN3C(=O)N2)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)