CAS 1571118-50-7 is the registry number for (R)-1-Azido-3-((3-fluoro-4-(morpholin-4-yl)phenyl)amino)propan-2-ol. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
[(2R)-3-(3-fluoro-4-morpholin-4-ylanilino)-2-hydroxypropyl]imino-iminoazanium (CAS 1571118-50-7) is a chemical compound with the molecular formula C13H19FN5O2+ and a molecular weight of 296.32 g/mol. IUPAC name: [(2R)-3-(3-fluoro-4-morpholin-4-ylanilino)-2-hydroxypropyl]imino-iminoazanium. InChIKey: GFBTVVZSAJCGGU-LLVKDONJSA-N.
| Molecular formula | C13H19FN5O2+ |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | [(2R)-3-(3-fluoro-4-morpholin-4-ylanilino)-2-hydroxypropyl]imino-iminoazanium |
| InChIKey | GFBTVVZSAJCGGU-LLVKDONJSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)NC[C@H](CN=[N+]=N)O)F |
Computed by PubChem (NCBI)