Products 1572047-63-2
CAS 1572047-63-2 is the registry number for p38α inhibitor 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-(4-fluorophenyl)-3-methyl-2-(2H-triazol-4-yl)imidazol-4-yl]pyridine (CAS 1572047-63-2) is a chemical compound with the molecular formula C17H13FN6 and a molecular weight of 320.32 g/mol. IUPAC name: 4-[5-(4-fluorophenyl)-3-methyl-2-(2H-triazol-4-yl)imidazol-4-yl]pyridine. InChIKey: JGMBDYVHJQPCAG-UHFFFAOYSA-N.
| Molecular formula | C17H13FN6 |
|---|---|
| Molecular weight | 320.32 g/mol |
| IUPAC name | 4-[5-(4-fluorophenyl)-3-methyl-2-(2H-triazol-4-yl)imidazol-4-yl]pyridine |
| InChIKey | JGMBDYVHJQPCAG-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=C1C2=NNN=C2)C3=CC=C(C=C3)F)C4=CC=NC=C4 |
Computed by PubChem (NCBI)
Synonyms:
p38|A inhibitor 8, orb2944466