CAS 15721-05-8 appears in our catalog under these names: Heptamethylcyclotetrasiloxane, >95% (GC), HEPTAMETHYL CYCLOTETRASILOXANE. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 10g.
2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (CAS 15721-05-8) is a chemical compound with the molecular formula C7H22O4Si4 and a molecular weight of 282.59 g/mol. IUPAC name: 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane. InChIKey: CLTMUXYRYKDGOK-UHFFFAOYSA-N.
| Molecular formula | C7H22O4Si4 |
|---|---|
| Molecular weight | 282.59 g/mol |
| IUPAC name | 2,2,4,4,6,6,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| InChIKey | CLTMUXYRYKDGOK-UHFFFAOYSA-N |
| SMILES | C[SiH]1O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C |
Computed by PubChem (NCBI)