CAS 157230-67-6 appears in our catalog under these names: 5-(Diethoxyphosphoryl)-5-methyl-1-pyrroline-N-oxide, >95% (HPLC), DEPMPO, 98%, DEPMPO, DEPMPO, 98%, 98%, DEPMPO, 99.84%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 50mg, 500mg, 10mg, 25mg, 100mg, 5 mg, 50 mg.
2-diethoxyphosphoryl-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium (CAS 157230-67-6) is a chemical compound with the molecular formula C9H18NO4P and a molecular weight of 235.22 g/mol. IUPAC name: 2-diethoxyphosphoryl-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium. InChIKey: OKCDBZSDRSXFIB-UHFFFAOYSA-N.
| Molecular formula | C9H18NO4P |
|---|---|
| Molecular weight | 235.22 g/mol |
| IUPAC name | 2-diethoxyphosphoryl-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium |
| InChIKey | OKCDBZSDRSXFIB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1(CCC=[N+]1[O-])C)OCC |
Computed by PubChem (NCBI)