CAS 157255-72-6 appears in our catalog under these names: 2-Methyl-4-iodo-1-tritylimidazole, 95%, 4-Iodo-2-methyl-1-trityl-1H-imidazole, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg.
4-iodo-2-methyl-1-tritylimidazole (CAS 157255-72-6) is a chemical compound with the molecular formula C23H19IN2 and a molecular weight of 450.3 g/mol. IUPAC name: 4-iodo-2-methyl-1-tritylimidazole. InChIKey: JSDCLDAMUNBJKV-UHFFFAOYSA-N.
| Molecular formula | C23H19IN2 |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | 4-iodo-2-methyl-1-tritylimidazole |
| InChIKey | JSDCLDAMUNBJKV-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)I |
Computed by PubChem (NCBI)