CAS 157310-73-1 appears in our catalog under these names: 1-Propyl-2,3-Dimethylimidazolium Hexafluorophosphate, 97%, 97%, 2,3–Dimethyl–1–propyl–1H–imidazol–3–ium hexafluorophosphate(V). Offered by: Chemat, GLPBio. Available pack sizes: 5g, 25g, 100g, 1g.
1,2-dimethyl-3-propylimidazol-1-ium hexafluorophosphate (CAS 157310-73-1) is a chemical compound with the molecular formula C8H15F6N2P and a molecular weight of 284.18 g/mol. IUPAC name: 1,2-dimethyl-3-propylimidazol-1-ium hexafluorophosphate. InChIKey: KTGUTSXSBOOTCB-UHFFFAOYSA-N.
| Molecular formula | C8H15F6N2P |
|---|---|
| Molecular weight | 284.18 g/mol |
| IUPAC name | 1,2-dimethyl-3-propylimidazol-1-ium hexafluorophosphate |
| InChIKey | KTGUTSXSBOOTCB-UHFFFAOYSA-N |
| SMILES | CCCN1C=C[N+](=C1C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)