CAS 1573547-68-8 is the registry number for (3-((Phenylsulfonyl)methyl)-1,2,4-oxadiazol-5-yl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[3-(benzenesulfonylmethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1573547-68-8) is a chemical compound with the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. IUPAC name: [3-(benzenesulfonylmethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: OUVFMAQNQJWMPT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O3S |
|---|---|
| Molecular weight | 289.74 g/mol |
| IUPAC name | [3-(benzenesulfonylmethyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | OUVFMAQNQJWMPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC2=NOC(=N2)CN.Cl |
Computed by PubChem (NCBI)