Products 157373-02-9
CAS 157373-02-9 is the registry number for ethyl 2-(3-chloro-2,4-difluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(3-chloro-2,4-difluorophenyl)-2-oxoacetate (CAS 157373-02-9) is a chemical compound with the molecular formula C10H7ClF2O3 and a molecular weight of 248.61 g/mol. IUPAC name: ethyl 2-(3-chloro-2,4-difluorophenyl)-2-oxoacetate. InChIKey: XEXOLSVSFWZWMS-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF2O3 |
|---|---|
| Molecular weight | 248.61 g/mol |
| IUPAC name | ethyl 2-(3-chloro-2,4-difluorophenyl)-2-oxoacetate |
| InChIKey | XEXOLSVSFWZWMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C(=C(C=C1)F)Cl)F |
Computed by PubChem (NCBI)