CAS 15738-23-5 appears in our catalog under these names: Sodium tetra(p-tolyl)borate, Sodium tetra-p-tolylborate 95+%, Sodium tetra-p-tolylborate, 95%+, 95%+. Offered by: Chemat, Ambeed. Available pack sizes: 10g, 500mg, 100mg, 250mg, 1g.
Sodium tetrakis(4-methylphenyl)boranuide (CAS 15738-23-5) is a chemical compound with the molecular formula C28H28BNa and a molecular weight of 398.3 g/mol. IUPAC name: sodium tetrakis(4-methylphenyl)boranuide. InChIKey: VVPGHQQFKGSIPJ-UHFFFAOYSA-N.
| Molecular formula | C28H28BNa |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | sodium tetrakis(4-methylphenyl)boranuide |
| InChIKey | VVPGHQQFKGSIPJ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)C)(C2=CC=C(C=C2)C)(C3=CC=C(C=C3)C)C4=CC=C(C=C4)C.[Na+] |
Computed by PubChem (NCBI)