CAS 157383-95-4 is the registry number for 3,3′-Dichloro-4,4′-difluorobenzil, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,2-bis(3-chloro-4-fluorophenyl)ethane-1,2-dione (CAS 157383-95-4) is a chemical compound with the molecular formula C14H6Cl2F2O2 and a molecular weight of 315.1 g/mol. IUPAC name: 1,2-bis(3-chloro-4-fluorophenyl)ethane-1,2-dione. InChIKey: YPGOCXYCJFVLPM-UHFFFAOYSA-N.
| Molecular formula | C14H6Cl2F2O2 |
|---|---|
| Molecular weight | 315.1 g/mol |
| IUPAC name | 1,2-bis(3-chloro-4-fluorophenyl)ethane-1,2-dione |
| InChIKey | YPGOCXYCJFVLPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(=O)C2=CC(=C(C=C2)F)Cl)Cl)F |
Computed by PubChem (NCBI)