CAS 1574285-06-5 appears in our catalog under these names: Potassium 4-ethylphenyl sulfate, 98%, 4-Ethylphenyl Sulfate Potassium Salt, >95% (HPLC), 4-Ethylphenyl-d4 sulfate potassium salt. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 2mg, 5mg, 10mg, 50mg.
Potassium (4-ethylphenyl) sulfate (CAS 1574285-06-5) is a chemical compound with the molecular formula C8H9KO4S and a molecular weight of 240.32 g/mol. IUPAC name: potassium (4-ethylphenyl) sulfate. InChIKey: WHBJOLRFIRVGDM-UHFFFAOYSA-M.
| Molecular formula | C8H9KO4S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | potassium (4-ethylphenyl) sulfate |
| InChIKey | WHBJOLRFIRVGDM-UHFFFAOYSA-M |
| SMILES | CCC1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)