CAS 15748-73-9 is the registry number for Lead salicylate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Bis(2-carboxyphenolate);lead(2+) (CAS 15748-73-9) is a chemical compound with the molecular formula C14H10O6Pb and a molecular weight of 481 g/mol. IUPAC name: bis(2-carboxyphenolate);lead(2+). InChIKey: CNVULGHYDPMIHD-UHFFFAOYSA-L.
| Molecular formula | C14H10O6Pb |
|---|---|
| Molecular weight | 481 g/mol |
| IUPAC name | bis(2-carboxyphenolate);lead(2+) |
| InChIKey | CNVULGHYDPMIHD-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[O-].C1=CC=C(C(=C1)C(=O)O)[O-].[Pb+2] |
Computed by PubChem (NCBI)