CAS 157487-95-1 appears in our catalog under these names: Dimethyl Phosphate-13C2 Sodium Salt, >95% (HPLC), Dimethyl Phosphate-13C2 (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 500 μg.
Sodium di(113C)methyl phosphate (CAS 157487-95-1) is a chemical compound with the molecular formula C2H6NaO4P and a molecular weight of 150.016 g/mol. IUPAC name: sodium di(113C)methyl phosphate. InChIKey: LMGRDVWNCARTPS-AWQJXPNKSA-M.
| Molecular formula | C2H6NaO4P |
|---|---|
| Molecular weight | 150.016 g/mol |
| IUPAC name | sodium di(113C)methyl phosphate |
| InChIKey | LMGRDVWNCARTPS-AWQJXPNKSA-M |
| SMILES | [13CH3]OP(=O)([O-])O[13CH3].[Na+] |
Computed by PubChem (NCBI)