Products 15754-20-8

CAS 15754-20-8 is the registry number for (E)-Acetophenone O-methyloxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

(E)-N-methoxy-1-phenylethanimine (CAS 15754-20-8) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: (E)-N-methoxy-1-phenylethanimine. InChIKey: FRRKMGKUCIICOM-CSKARUKUSA-N.

Identity
Molecular formulaC9H11NO
Molecular weight149.19 g/mol
IUPAC name(E)-N-methoxy-1-phenylethanimine
InChIKeyFRRKMGKUCIICOM-CSKARUKUSA-N
SMILESC/C(=N\OC)/C1=CC=CC=C1

Computed by PubChem (NCBI)