CAS 157671-99-3 appears in our catalog under these names: 2-(4-(Methylsulfonyl)phenyl)-2-oxoethyl 2-(4-fluorophenyl)aceta, 95%, 2–(4–(methylsulfonyl)phenyl)–2–oxoethyl 2–(4–fluorophenyl)aceta. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
[2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)acetate (CAS 157671-99-3) is a chemical compound with the molecular formula C17H15FO5S and a molecular weight of 350.4 g/mol. IUPAC name: [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)acetate. InChIKey: VQPCKDIXGVQMCG-UHFFFAOYSA-N.
| Molecular formula | C17H15FO5S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [2-(4-methylsulfonylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)acetate |
| InChIKey | VQPCKDIXGVQMCG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)COC(=O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)