CAS 157672-00-9 appears in our catalog under these names: 3-(4-Fluorophenyl)-4-(4-(methylsulfonyl)phenyl)furan-2(5H)-one, 97%, 3–(4–fluorophenyl)–4–(4–(methylsulfonyl)phenyl)furan–2(5H)–one. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one (CAS 157672-00-9) is a chemical compound with the molecular formula C17H13FO4S and a molecular weight of 332.3 g/mol. IUPAC name: 4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one. InChIKey: ZRCURVJXQGLLOZ-UHFFFAOYSA-N.
| Molecular formula | C17H13FO4S |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-3-(4-methylsulfonylphenyl)-2H-furan-5-one |
| InChIKey | ZRCURVJXQGLLOZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(C(=O)OC2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)