CAS 1577-62-4 is the registry number for N-Trifluoroacetyl-l-cysteine methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 1577-62-4) is a chemical compound with the molecular formula C6H8F3NO3S and a molecular weight of 231.20 g/mol. IUPAC name: methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: VWGSQMAKRLENER-VKHMYHEASA-N.
| Molecular formula | C6H8F3NO3S |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| InChIKey | VWGSQMAKRLENER-VKHMYHEASA-N |
| SMILES | COC(=O)[C@H](CS)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)