Products 1577-62-4

CAS 1577-62-4 is the registry number for N-Trifluoroacetyl-l-cysteine methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 1577-62-4) is a chemical compound with the molecular formula C6H8F3NO3S and a molecular weight of 231.20 g/mol. IUPAC name: methyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: VWGSQMAKRLENER-VKHMYHEASA-N.

Identity
Molecular formulaC6H8F3NO3S
Molecular weight231.20 g/mol
IUPAC namemethyl (2R)-3-sulfanyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate
InChIKeyVWGSQMAKRLENER-VKHMYHEASA-N
SMILESCOC(=O)[C@H](CS)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)