CAS 1577187-73-5 is the registry number for 4-(3,4-Dimethylphenyl)-1-phenyl-1H-1,2,3-triazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-(3,4-dimethylphenyl)-1-phenyltriazole (CAS 1577187-73-5) is a chemical compound with the molecular formula C16H15N3 and a molecular weight of 249.31 g/mol. IUPAC name: 4-(3,4-dimethylphenyl)-1-phenyltriazole. InChIKey: IWRDFHURLYXCQT-UHFFFAOYSA-N.
| Molecular formula | C16H15N3 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 4-(3,4-dimethylphenyl)-1-phenyltriazole |
| InChIKey | IWRDFHURLYXCQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CN(N=N2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)