CAS 157723-26-7 is the registry number for POLY(DIMETHYLSILOXANE), MONOGLYCIDYL ET&. Offered by: Sigma-Aldrich. Available pack sizes: 25ML.
[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethyl-trimethylsilyloxysilane (CAS 157723-26-7) is a chemical compound with the molecular formula C13H32O4Si3 and a molecular weight of 336.65 g/mol. IUPAC name: [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethyl-trimethylsilyloxysilane. InChIKey: RBIDBLBWLVIZMS-UHFFFAOYSA-N.
| Molecular formula | C13H32O4Si3 |
|---|---|
| Molecular weight | 336.65 g/mol |
| IUPAC name | [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethyl-trimethylsilyloxysilane |
| InChIKey | RBIDBLBWLVIZMS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOCC1CO1 |
Computed by PubChem (NCBI)