CAS 15776-98-4 is the registry number for 1-Ethyl-5,6-dimethyl-1H-benzo[d]imidazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-ethyl-5,6-dimethylbenzimidazole (CAS 15776-98-4) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: 1-ethyl-5,6-dimethylbenzimidazole. InChIKey: YCJYZUKUIGPUHA-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-ethyl-5,6-dimethylbenzimidazole |
| InChIKey | YCJYZUKUIGPUHA-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C=C(C(=C2)C)C |
Computed by PubChem (NCBI)