CAS 157764-03-9 is the registry number for 2-(5-Chloro-1,3-benzothiazol-2-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-chloro-1,3-benzothiazol-2-yl)acetonitrile (CAS 157764-03-9) is a chemical compound with the molecular formula C9H5ClN2S and a molecular weight of 208.67 g/mol. IUPAC name: 2-(5-chloro-1,3-benzothiazol-2-yl)acetonitrile. InChIKey: GCOTWHHKZPEEEV-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2S |
|---|---|
| Molecular weight | 208.67 g/mol |
| IUPAC name | 2-(5-chloro-1,3-benzothiazol-2-yl)acetonitrile |
| InChIKey | GCOTWHHKZPEEEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(S2)CC#N |
Computed by PubChem (NCBI)