CAS 157764-07-3 is the registry number for 6-Fluoro-2-benzothiazoleacetonitrile. Offered by: TRC. Available pack sizes: 1g.
2-(6-fluoro-1,3-benzothiazol-2-yl)acetonitrile (CAS 157764-07-3) is a chemical compound with the molecular formula C9H5FN2S and a molecular weight of 192.21 g/mol. IUPAC name: 2-(6-fluoro-1,3-benzothiazol-2-yl)acetonitrile. InChIKey: UZLYTHPJJKORPV-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2S |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-(6-fluoro-1,3-benzothiazol-2-yl)acetonitrile |
| InChIKey | UZLYTHPJJKORPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)SC(=N2)CC#N |
Computed by PubChem (NCBI)