CAS 157810-06-5 is the registry number for Pilocarpine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-(3-amino-2-oxopropyl)-3-ethyloxolan-2-one (CAS 157810-06-5) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: (3S,4R)-4-(3-amino-2-oxopropyl)-3-ethyloxolan-2-one. InChIKey: GMCMOEPNHDEGGH-XPUUQOCRSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | (3S,4R)-4-(3-amino-2-oxopropyl)-3-ethyloxolan-2-one |
| InChIKey | GMCMOEPNHDEGGH-XPUUQOCRSA-N |
| SMILES | CC[C@H]1[C@H](COC1=O)CC(=O)CN |
Computed by PubChem (NCBI)