CAS 157843-42-0 is the registry number for 2-Chloro-4-nitrophenyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-chloro-4-nitrophenoxy)-2-methyloxan-3-yl] acetate (CAS 157843-42-0) is a chemical compound with the molecular formula C18H20ClNO10 and a molecular weight of 445.8 g/mol. IUPAC name: [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-chloro-4-nitrophenoxy)-2-methyloxan-3-yl] acetate. InChIKey: LSRSCMJOWCZEJR-MFOCEMHGSA-N.
| Molecular formula | C18H20ClNO10 |
|---|---|
| Molecular weight | 445.8 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6S)-4,5-diacetyloxy-6-(2-chloro-4-nitrophenoxy)-2-methyloxan-3-yl] acetate |
| InChIKey | LSRSCMJOWCZEJR-MFOCEMHGSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC2=C(C=C(C=C2)[N+](=O)[O-])Cl)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)