CAS 157862-84-5 appears in our catalog under these names: PDE5–IN–9, PDE5-IN-9/ 100%, 2-(Pyridin-3-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine, 98%, 98%, PDE5-IN-9, 98.0%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 5 mg.
2-pyridin-3-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine (CAS 157862-84-5) is a chemical compound with the molecular formula C18H14N4S and a molecular weight of 318.4 g/mol. IUPAC name: 2-pyridin-3-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine. InChIKey: LOPGUWAPDVMPKH-UHFFFAOYSA-N.
| Molecular formula | C18H14N4S |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 2-pyridin-3-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
| InChIKey | LOPGUWAPDVMPKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CN=CC=C3)NCC4=CC=CS4 |
Computed by PubChem (NCBI)